C17H26N6 — CID 95761539
2-[(2S)-3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-(2-pyridin-2-ylethyl)guanidine (PubChem CID 95761539) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is 2-[(2S)-3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[(2S)-3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 95761539 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 2-[(2S)-3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-(2-pyridin-2-ylethyl)guanidine |
| SMILES | Cc1cc(C)n(C[C@@H](C)C/N=C(\N)NCCc2ccccn2)n1 |
| InChI | InChI=1S/C17H26N6/c1-13(12-23-15(3)10-14(2)22-23)11-21-17(18)20-9-7-16-6-4-5-8-19-16/h4-6,8,10,13H,7,9,11-12H2,1-3H3,(H3,18,20,21)/t13-/m0/s1 |
| InChIKey | JBXFZRGUIRQRCK-ZDUSSCGKSA-N |
| XLogP | 1.68 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|