C15H21IN4S — CID 111816863
1-(2-pyridin-2-ylethyl)-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111816863) has the molecular formula C15H21IN4S and a molecular weight of 416.33 g/mol. Its IUPAC name is 1-(2-pyridin-2-ylethyl)-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(2-pyridin-2-ylethyl)-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111816863 |
| Molecular Formula | C15H21IN4S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 1-(2-pyridin-2-ylethyl)-2-(2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CC(C/N=C(\N)NCCc1ccccn1)c1cccs1.I |
| InChI | InChI=1S/C15H20N4S.HI/c1-12(14-6-4-10-20-14)11-19-15(16)18-9-7-13-5-2-3-8-17-13;/h2-6,8,10,12H,7,9,11H2,1H3,(H3,16,18,19);1H |
| InChIKey | OSFPBQWJKIAZMC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|