C15H20N4S — CID 111704436
1-(2-pyridin-2-ylethyl)-2-(2-thiophen-3-ylpropyl)guanidine (PubChem CID 111704436) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-(2-pyridin-2-ylethyl)-2-(2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-(2-pyridin-2-ylethyl)-2-(2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111704436 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-(2-pyridin-2-ylethyl)-2-(2-thiophen-3-ylpropyl)guanidine |
| SMILES | CC(C/N=C(\N)NCCc1ccccn1)c1ccsc1 |
| InChI | InChI=1S/C15H20N4S/c1-12(13-6-9-20-11-13)10-19-15(16)18-8-5-14-4-2-3-7-17-14/h2-4,6-7,9,11-12H,5,8,10H2,1H3,(H3,16,18,19) |
| InChIKey | TXDRYJGJHSNWAL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|