C18H31N5O2 — CID 111808792
tert-butyl N-[3-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate (PubChem CID 111808792) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 111808792 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | tert-butyl N-[3-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate |
| SMILES | CC(C/N=C(\N)NCCc1ccccn1)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N5O2/c1-14(13-23(5)17(24)25-18(2,3)4)12-22-16(19)21-11-9-15-8-6-7-10-20-15/h6-8,10,14H,9,11-13H2,1-5H3,(H3,19,21,22) |
| InChIKey | NJWWBIHSRDKAHM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|