C16H23IN4S — CID 111673485
2-(2-methyl-3-thiophen-2-ylpropyl)-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111673485) has the molecular formula C16H23IN4S and a molecular weight of 430.36 g/mol. Its IUPAC name is 2-(2-methyl-3-thiophen-2-ylpropyl)-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-(2-methyl-3-thiophen-2-ylpropyl)-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111673485 |
| Molecular Formula | C16H23IN4S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-(2-methyl-3-thiophen-2-ylpropyl)-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CC(C/N=C(\N)NCCc1ccccn1)Cc1cccs1.I |
| InChI | InChI=1S/C16H22N4S.HI/c1-13(11-15-6-4-10-21-15)12-20-16(17)19-9-7-14-5-2-3-8-18-14;/h2-6,8,10,13H,7,9,11-12H2,1H3,(H3,17,19,20);1H |
| InChIKey | GMFPQTWWILTVLI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|