C24H33N5O2 — CID 111818442
tert-butyl N-[4-[[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]methyl]-2-methylphenyl]-N-cyclopropylcarbamate (PubChem CID 111818442) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is tert-butyl N-[4-[[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]methyl]-2-methylphenyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[4-[[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]methyl]-2-methylphenyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 111818442 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | tert-butyl N-[4-[[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]methyl]-2-methylphenyl]-N-cyclopropylcarbamate |
| SMILES | Cc1cc(C/N=C(\N)NCCc2ccccn2)ccc1N(C(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C24H33N5O2/c1-17-15-18(16-28-22(25)27-14-12-19-7-5-6-13-26-19)8-11-21(17)29(20-9-10-20)23(30)31-24(2,3)4/h5-8,11,13,15,20H,9-10,12,14,16H2,1-4H3,(H3,25,27,28) |
| InChIKey | RQQWZESUTCRYGA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|