C20H27FIN5O — CID 111068410
2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111068410) has the molecular formula C20H27FIN5O and a molecular weight of 499.37 g/mol. Its IUPAC name is 2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111068410 |
| Molecular Formula | C20H27FIN5O |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)NCCc1ccccn1 |
| InChI | InChI=1S/C20H26FN5O.HI/c21-18-13-15(4-5-19(18)26-11-7-17(27)8-12-26)14-25-20(22)24-10-6-16-3-1-2-9-23-16;/h1-5,9,13,17,27H,6-8,10-12,14H2,(H3,22,24,25);1H |
| InChIKey | XEKVVTNMFCRYCH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|