C21H28FIN4O3 — CID 111068408
1-(3,4-dimethoxyphenyl)-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111068408) has the molecular formula C21H28FIN4O3 and a molecular weight of 530.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111068408 |
| Molecular Formula | C21H28FIN4O3 |
| Molecular Weight | 530.38 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc(N3CCC(O)CC3)c(F)c2)cc1OC.I |
| InChI | InChI=1S/C21H27FN4O3.HI/c1-28-19-6-4-15(12-20(19)29-2)25-21(23)24-13-14-3-5-18(17(22)11-14)26-9-7-16(27)8-10-26;/h3-6,11-12,16,27H,7-10,13H2,1-2H3,(H3,23,24,25);1H |
| InChIKey | NSOOHYXSOLEIIF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|