C13H22N4 — CID 12969619
1,3-diethyl-5-(pyridin-2-ylmethyl)-1,3,5-triazinane (PubChem CID 12969619) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 1,3-diethyl-5-(pyridin-2-ylmethyl)-1,3,5-triazinane.
| Compound Name | 1,3-diethyl-5-(pyridin-2-ylmethyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 12969619 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1,3-diethyl-5-(pyridin-2-ylmethyl)-1,3,5-triazinane |
| SMILES | CCN1CN(CC)CN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C13H22N4/c1-3-15-10-16(4-2)12-17(11-15)9-13-7-5-6-8-14-13/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | JVGXKHZEKMYBDM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |