C10H13ClN2 — CID 10198073
2-(6-chloro-2,3-dihydroindol-1-yl)ethanamine (PubChem CID 10198073) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 2-(6-chloro-2,3-dihydroindol-1-yl)ethanamine.
| Compound Name | 2-(6-chloro-2,3-dihydroindol-1-yl)ethanamine |
|---|---|
| PubChem CID | 10198073 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(6-chloro-2,3-dihydroindol-1-yl)ethanamine |
| SMILES | NCCN1CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H13ClN2/c11-9-2-1-8-3-5-13(6-4-12)10(8)7-9/h1-2,7H,3-6,12H2 |
| InChIKey | LVIRPARUNBTHAR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |