C26H28BNO2 — CID 169262142
2-(9,9-dimethylfluoren-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 169262142) has the molecular formula C26H28BNO2 and a molecular weight of 397.33 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 169262142 |
| Molecular Formula | C26H28BNO2 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ncccc3B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C26H28BNO2/c1-24(2)20-11-8-7-10-18(20)19-14-13-17(16-21(19)24)23-22(12-9-15-28-23)27-29-25(3,4)26(5,6)30-27/h7-16H,1-6H3 |
| InChIKey | QYAMVWGNZOKXLX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|