C35H32BNO2Si — CID 169262163
2-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 169262163) has the molecular formula C35H32BNO2Si and a molecular weight of 537.54 g/mol. Its IUPAC name is 2-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 169262163 |
| Molecular Formula | C35H32BNO2Si |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 2-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2cccnc2-c2ccc3c(c2)[Si](c2ccccc2)(c2ccccc2)c2ccccc2-3)OC1(C)C |
| InChI | InChI=1S/C35H32BNO2Si/c1-34(2)35(3,4)39-36(38-34)30-19-13-23-37-33(30)25-21-22-29-28-18-11-12-20-31(28)40(32(29)24-25,26-14-7-5-8-15-26)27-16-9-6-10-17-27/h5-24H,1-4H3 |
| InChIKey | JHYIIXTVEJGAKJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|