C21H21BF4N2O3 — CID 171527982
6-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 171527982) has the molecular formula C21H21BF4N2O3 and a molecular weight of 436.21 g/mol. Its IUPAC name is 6-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 171527982 |
| Molecular Formula | C21H21BF4N2O3 |
| Molecular Weight | 436.21 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 6-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CC1(C)OB(c2cc(F)c(CN3Cc4ncccc4C3=O)c(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C21H21BF4N2O3/c1-19(2)20(3,4)31-22(30-19)12-8-15(21(24,25)26)14(16(23)9-12)10-28-11-17-13(18(28)29)6-5-7-27-17/h5-9H,10-11H2,1-4H3 |
| InChIKey | OOBPGMKPLCLTRQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|