C21H24BFN2O3 — CID 171528087
6-[[2-fluoro-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one (PubChem CID 171528087) has the molecular formula C21H24BFN2O3 and a molecular weight of 382.24 g/mol. Its IUPAC name is 6-[[2-fluoro-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one.
| Compound Name | 6-[[2-fluoro-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 171528087 |
| Molecular Formula | C21H24BFN2O3 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 6-[[2-fluoro-6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(F)c1CN1Cc2cccnc2C1=O |
| InChI | InChI=1S/C21H24BFN2O3/c1-13-9-15(22-27-20(2,3)21(4,5)28-22)10-17(23)16(13)12-25-11-14-7-6-8-24-18(14)19(25)26/h6-10H,11-12H2,1-5H3 |
| InChIKey | PDUZXCGDMYJGFS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|