C19H21BFN3O3 — CID 171528097
6-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one (PubChem CID 171528097) has the molecular formula C19H21BFN3O3 and a molecular weight of 369.21 g/mol. Its IUPAC name is 6-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one.
| Compound Name | 6-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 171528097 |
| Molecular Formula | C19H21BFN3O3 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 6-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]-5H-pyrrolo[3,4-b]pyridin-7-one |
| SMILES | CC1(C)OB(c2cnc(CN3Cc4cccnc4C3=O)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C19H21BFN3O3/c1-18(2)19(3,4)27-20(26-18)13-8-14(21)15(23-9-13)11-24-10-12-6-5-7-22-16(12)17(24)25/h5-9H,10-11H2,1-4H3 |
| InChIKey | WRFNGIZOOSNJPT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|