C15H19BF3NO3 — CID 155646023
2-[(2,2-difluorocyclopropyl)methoxy]-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 155646023) has the molecular formula C15H19BF3NO3 and a molecular weight of 329.13 g/mol. Its IUPAC name is 2-[(2,2-difluorocyclopropyl)methoxy]-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-[(2,2-difluorocyclopropyl)methoxy]-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 155646023 |
| Molecular Formula | C15H19BF3NO3 |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[(2,2-difluorocyclopropyl)methoxy]-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2cnc(OCC3CC3(F)F)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C15H19BF3NO3/c1-13(2)14(3,4)23-16(22-13)10-5-11(17)12(20-7-10)21-8-9-6-15(9,18)19/h5,7,9H,6,8H2,1-4H3 |
| InChIKey | QSGHUEGQSBIENV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|