C19H30BNO4 — CID 176666786
2-[(2R,6S)-2,6-dimethyloxan-4-yl]oxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 176666786) has the molecular formula C19H30BNO4 and a molecular weight of 347.26 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethyloxan-4-yl]oxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-[(2R,6S)-2,6-dimethyloxan-4-yl]oxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 176666786 |
| Molecular Formula | C19H30BNO4 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethyloxan-4-yl]oxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cnc1OC1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C19H30BNO4/c1-12-8-15(20-24-18(4,5)19(6,7)25-20)11-21-17(12)23-16-9-13(2)22-14(3)10-16/h8,11,13-14,16H,9-10H2,1-7H3/t13-,14+,16? |
| InChIKey | PARVXHIBYDBHSD-MZBDJJRSSA-N |
| XLogP | 3.02 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|