C14H21BClNO3 — CID 58042491
3-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 58042491) has the molecular formula C14H21BClNO3 and a molecular weight of 304.63 g/mol. Its IUPAC name is 3-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 58042491 |
| Molecular Formula | C14H21BClNO3 |
| Molecular Weight | 304.63 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | [2H]C([2H])([2H])C([2H])(Oc1ncc(B2OC(C)(C)C(C)(C)O2)cc1Cl)C([2H])([2H])[2H] |
| InChI | InChI=1S/C14H21BClNO3/c1-9(2)18-12-11(16)7-10(8-17-12)15-19-13(3,4)14(5,6)20-15/h7-9H,1-6H3/i1D3,2D3,9D |
| InChIKey | AEBYJEIVJUEVBL-SCENNGIESA-N |
| XLogP | 2.82 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|