C14H18BF4NO3 — CID 147462562
3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyridine (PubChem CID 147462562) has the molecular formula C14H18BF4NO3 and a molecular weight of 335.11 g/mol. Its IUPAC name is 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyridine.
| Compound Name | 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyridine |
|---|---|
| PubChem CID | 147462562 |
| Molecular Formula | C14H18BF4NO3 |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyridine |
| SMILES | C[C@H](Oc1ncc(B2OC(C)(C)C(C)(C)O2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C14H18BF4NO3/c1-8(14(17,18)19)21-11-10(16)6-9(7-20-11)15-22-12(2,3)13(4,5)23-15/h6-8H,1-5H3/t8-/m0/s1 |
| InChIKey | FAFAJSLJZYLKIB-QMMMGPOBSA-N |
| XLogP | 2.85 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|