C19H31BF2N2O3 — CID 140794468
(2S)-1-[[3-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine (PubChem CID 140794468) has the molecular formula C19H31BF2N2O3 and a molecular weight of 384.28 g/mol. Its IUPAC name is (2S)-1-[[3-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine.
| Compound Name | (2S)-1-[[3-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 140794468 |
| Molecular Formula | C19H31BF2N2O3 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (2S)-1-[[3-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
| SMILES | CC(C)C[C@](C)(N)COc1ncc(B2OC(C)(C)C(C)(C)O2)cc1C(F)F |
| InChI | InChI=1S/C19H31BF2N2O3/c1-12(2)9-19(7,23)11-25-16-14(15(21)22)8-13(10-24-16)20-26-17(3,4)18(5,6)27-20/h8,10,12,15H,9,11,23H2,1-7H3/t19-/m0/s1 |
| InChIKey | VIWHCDRFEQOOOX-IBGZPJMESA-N |
| XLogP | 3.46 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|