C17H28BFNO3P — CID 174101839
[2-(2-fluoro-2-methylpropoxy)-5-(4,4,5-trimethyl-5-propyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phosphane (PubChem CID 174101839) has the molecular formula C17H28BFNO3P and a molecular weight of 355.20 g/mol. Its IUPAC name is [2-(2-fluoro-2-methylpropoxy)-5-(4,4,5-trimethyl-5-propyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phosphane.
| Compound Name | [2-(2-fluoro-2-methylpropoxy)-5-(4,4,5-trimethyl-5-propyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phosphane |
|---|---|
| PubChem CID | 174101839 |
| Molecular Formula | C17H28BFNO3P |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [2-(2-fluoro-2-methylpropoxy)-5-(4,4,5-trimethyl-5-propyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phosphane |
| SMILES | CCCC1(C)OB(c2cnc(OCC(C)(C)F)c(P)c2)OC1(C)C |
| InChI | InChI=1S/C17H28BFNO3P/c1-7-8-17(6)16(4,5)22-18(23-17)12-9-13(24)14(20-10-12)21-11-15(2,3)19/h9-10H,7-8,11,24H2,1-6H3 |
| InChIKey | ILBCNSWSNUPKDO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|