C23H38BClN2O5 — CID 140794469
tert-butyl N-[(2S)-1-[[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]carbamate (PubChem CID 140794469) has the molecular formula C23H38BClN2O5 and a molecular weight of 468.83 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 140794469 |
| Molecular Formula | C23H38BClN2O5 |
| Molecular Weight | 468.83 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]carbamate |
| SMILES | CC(C)C[C@@](C)(COc1ncc(B2OC(C)(C)C(C)(C)O2)cc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H38BClN2O5/c1-15(2)12-23(10,27-19(28)30-20(3,4)5)14-29-18-17(25)11-16(13-26-18)24-31-21(6,7)22(8,9)32-24/h11,13,15H,12,14H2,1-10H3,(H,27,28)/t23-/m0/s1 |
| InChIKey | IZNUJZQYEYJGOP-QHCPKHFHSA-N |
| XLogP | 4.74 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.83 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|