C24H39BClNO5 — CID 175083798
(1-amino-2-methylpropan-2-yl) (2S)-2-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]-2,4-dimethylpentanoate (PubChem CID 175083798) has the molecular formula C24H39BClNO5 and a molecular weight of 467.84 g/mol. Its IUPAC name is (1-amino-2-methylpropan-2-yl) (2S)-2-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]-2,4-dimethylpentanoate.
| Compound Name | (1-amino-2-methylpropan-2-yl) (2S)-2-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 175083798 |
| Molecular Formula | C24H39BClNO5 |
| Molecular Weight | 467.84 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | (1-amino-2-methylpropan-2-yl) (2S)-2-[[2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]-2,4-dimethylpentanoate |
| SMILES | CC(C)C[C@@](C)(COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1Cl)C(=O)OC(C)(C)CN |
| InChI | InChI=1S/C24H39BClNO5/c1-16(2)13-24(9,20(28)30-21(3,4)14-27)15-29-19-11-10-17(12-18(19)26)25-31-22(5,6)23(7,8)32-25/h10-12,16H,13-15,27H2,1-9H3/t24-/m0/s1 |
| InChIKey | OIQBVJKCGMYTDL-DEOSSOPVSA-N |
| XLogP | 4.35 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|