C13H18FNO3 — CID 114034719
[2-(2,6-dimethyloxan-4-yl)oxy-5-fluoro-3-pyridinyl]methanol (PubChem CID 114034719) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is [2-(2,6-dimethyloxan-4-yl)oxy-5-fluoro-3-pyridinyl]methanol.
| Compound Name | [2-(2,6-dimethyloxan-4-yl)oxy-5-fluoro-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 114034719 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | [2-(2,6-dimethyloxan-4-yl)oxy-5-fluoro-3-pyridinyl]methanol |
| SMILES | CC1CC(Oc2ncc(F)cc2CO)CC(C)O1 |
| InChI | InChI=1S/C13H18FNO3/c1-8-3-12(4-9(2)17-8)18-13-10(7-16)5-11(14)6-15-13/h5-6,8-9,12,16H,3-4,7H2,1-2H3 |
| InChIKey | LLYDIOQHABRLBV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |