C17H23BN2O4 — CID 76847586
2-(oxolan-3-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile (PubChem CID 76847586) has the molecular formula C17H23BN2O4 and a molecular weight of 330.19 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2-(oxolan-3-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 76847586 |
| Molecular Formula | C17H23BN2O4 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-(oxolan-3-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
| SMILES | CC1(C)OB(c2cnc(OCC3CCOC3)c(C#N)c2)OC1(C)C |
| InChI | InChI=1S/C17H23BN2O4/c1-16(2)17(3,4)24-18(23-16)14-7-13(8-19)15(20-9-14)22-11-12-5-6-21-10-12/h7,9,12H,5-6,10-11H2,1-4H3 |
| InChIKey | GIUPWMQBVFEYFZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|