C16H22BN3O3 — CID 76847548
2-(oxetan-3-ylmethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile (PubChem CID 76847548) has the molecular formula C16H22BN3O3 and a molecular weight of 315.18 g/mol. Its IUPAC name is 2-(oxetan-3-ylmethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2-(oxetan-3-ylmethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 76847548 |
| Molecular Formula | C16H22BN3O3 |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-(oxetan-3-ylmethylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
| SMILES | CC1(C)OB(c2cnc(NCC3COC3)c(C#N)c2)OC1(C)C |
| InChI | InChI=1S/C16H22BN3O3/c1-15(2)16(3,4)23-17(22-15)13-5-12(6-18)14(20-8-13)19-7-11-9-21-10-11/h5,8,11H,7,9-10H2,1-4H3,(H,19,20) |
| InChIKey | BSAAKULLLDLLCW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|