C15H21BN2O4 — CID 76847630
2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile (PubChem CID 76847630) has the molecular formula C15H21BN2O4 and a molecular weight of 304.16 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 76847630 |
| Molecular Formula | C15H21BN2O4 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
| SMILES | COCCOc1ncc(B2OC(C)(C)C(C)(C)O2)cc1C#N |
| InChI | InChI=1S/C15H21BN2O4/c1-14(2)15(3,4)22-16(21-14)12-8-11(9-17)13(18-10-12)20-7-6-19-5/h8,10H,6-7H2,1-5H3 |
| InChIKey | XAIFNFVWBOTUFU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 73.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|