C14H18BNO3 — CID 157499306
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,7-dihydrocyclopenta[b]pyridin-6-one (PubChem CID 157499306) has the molecular formula C14H18BNO3 and a molecular weight of 259.11 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,7-dihydrocyclopenta[b]pyridin-6-one.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,7-dihydrocyclopenta[b]pyridin-6-one |
|---|---|
| PubChem CID | 157499306 |
| Molecular Formula | C14H18BNO3 |
| Molecular Weight | 259.11 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,7-dihydrocyclopenta[b]pyridin-6-one |
| SMILES | CC1(C)OB(c2cnc3c(c2)CC(=O)C3)OC1(C)C |
| InChI | InChI=1S/C14H18BNO3/c1-13(2)14(3,4)19-15(18-13)10-5-9-6-11(17)7-12(9)16-8-10/h5,8H,6-7H2,1-4H3 |
| InChIKey | BYFGKPXWPLZSPA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.11 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|