C13H16BN3O3 — CID 137272926
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyrido[3,2-d]pyrimidin-4-one (PubChem CID 137272926) has the molecular formula C13H16BN3O3 and a molecular weight of 273.10 g/mol. Its IUPAC name is 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137272926 |
| Molecular Formula | C13H16BN3O3 |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyrido[3,2-d]pyrimidin-4-one |
| SMILES | CC1(C)OB(c2cnc3c(=O)[nH]cnc3c2)OC1(C)C |
| InChI | InChI=1S/C13H16BN3O3/c1-12(2)13(3,4)20-14(19-12)8-5-9-10(15-6-8)11(18)17-7-16-9/h5-7H,1-4H3,(H,16,17,18) |
| InChIKey | CTUTXDDPZZHAKL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|