C12H17BN2O5 — CID 140621922
3-methoxy-2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 140621922) has the molecular formula C12H17BN2O5 and a molecular weight of 280.09 g/mol. Its IUPAC name is 3-methoxy-2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-methoxy-2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 140621922 |
| Molecular Formula | C12H17BN2O5 |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-methoxy-2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17BN2O5/c1-11(2)12(3,4)20-13(19-11)8-6-9(18-5)10(14-7-8)15(16)17/h6-7H,1-5H3 |
| InChIKey | VEIGRQRXYVIIRW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|