C15H19BN2O4 — CID 167719520
8-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 167719520) has the molecular formula C15H19BN2O4 and a molecular weight of 302.14 g/mol. Its IUPAC name is 8-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 8-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 167719520 |
| Molecular Formula | C15H19BN2O4 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 8-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)cn2c(C=O)cnc12 |
| InChI | InChI=1S/C15H19BN2O4/c1-14(2)15(3,4)22-16(21-14)10-6-12(20-5)13-17-7-11(9-19)18(13)8-10/h6-9H,1-5H3 |
| InChIKey | SYKUHZZIRZYYRB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|