C19H24BN3O5 — CID 75487129
N-[(4-methoxyphenyl)methyl]-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 75487129) has the molecular formula C19H24BN3O5 and a molecular weight of 385.23 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 75487129 |
| Molecular Formula | C19H24BN3O5 |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | COc1ccc(CNc2ncc(B3OC(C)(C)C(C)(C)O3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H24BN3O5/c1-18(2)19(3,4)28-20(27-18)14-10-16(23(24)25)17(22-12-14)21-11-13-6-8-15(26-5)9-7-13/h6-10,12H,11H2,1-5H3,(H,21,22) |
| InChIKey | ULZLUDQAAMAUNG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|