C20H25BN2O5 — CID 75486340
4-[(4-methoxyphenyl)methyl]-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 75486340) has the molecular formula C20H25BN2O5 and a molecular weight of 384.24 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methyl]-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 4-[(4-methoxyphenyl)methyl]-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 75486340 |
| Molecular Formula | C20H25BN2O5 |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 4-[(4-methoxyphenyl)methyl]-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | COc1ccc(Cc2cc(B3OC(C)(C)C(C)(C)O3)c(N)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H25BN2O5/c1-19(2)20(3,4)28-21(27-19)16-11-14(12-17(18(16)22)23(24)25)10-13-6-8-15(26-5)9-7-13/h6-9,11-12H,10,22H2,1-5H3 |
| InChIKey | QUPSXSZTSXKHJU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|