C11H17BN4O4 — CID 75487116
[3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]hydrazine (PubChem CID 75487116) has the molecular formula C11H17BN4O4 and a molecular weight of 280.09 g/mol. Its IUPAC name is [3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]hydrazine.
| Compound Name | [3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 75487116 |
| Molecular Formula | C11H17BN4O4 |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]hydrazine |
| SMILES | CC1(C)OB(c2cnc(NN)c([N+](=O)[O-])c2)OC1(C)C |
| InChI | InChI=1S/C11H17BN4O4/c1-10(2)11(3,4)20-12(19-10)7-5-8(16(17)18)9(15-13)14-6-7/h5-6H,13H2,1-4H3,(H,14,15) |
| InChIKey | FLQMHWKMKCVGNA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|