C6H5N5O2 — CID 103470111
6-hydrazinyl-5-nitropyridine-3-carbonitrile (PubChem CID 103470111) has the molecular formula C6H5N5O2 and a molecular weight of 179.14 g/mol. Its IUPAC name is 6-hydrazinyl-5-nitropyridine-3-carbonitrile.
| Compound Name | 6-hydrazinyl-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103470111 |
| Molecular Formula | C6H5N5O2 |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 6-hydrazinyl-5-nitropyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(NN)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H5N5O2/c7-2-4-1-5(11(12)13)6(10-8)9-3-4/h1,3H,8H2,(H,9,10) |
| InChIKey | GHCWYWFSWJXFLF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|