C14H18N4O2 — CID 103471718
6-[(4,4-dimethylcyclohexyl)amino]-5-nitropyridine-3-carbonitrile (PubChem CID 103471718) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 6-[(4,4-dimethylcyclohexyl)amino]-5-nitropyridine-3-carbonitrile.
| Compound Name | 6-[(4,4-dimethylcyclohexyl)amino]-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103471718 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 6-[(4,4-dimethylcyclohexyl)amino]-5-nitropyridine-3-carbonitrile |
| SMILES | CC1(C)CCC(Nc2ncc(C#N)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H18N4O2/c1-14(2)5-3-11(4-6-14)17-13-12(18(19)20)7-10(8-15)9-16-13/h7,9,11H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | CUFTZDJBCVARCF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|