C11H11N5O3 — CID 103471557
5-nitro-6-[(2-oxopiperidin-3-yl)amino]pyridine-3-carbonitrile (PubChem CID 103471557) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is 5-nitro-6-[(2-oxopiperidin-3-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 5-nitro-6-[(2-oxopiperidin-3-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103471557 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-nitro-6-[(2-oxopiperidin-3-yl)amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(NC2CCCNC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N5O3/c12-5-7-4-9(16(18)19)10(14-6-7)15-8-2-1-3-13-11(8)17/h4,6,8H,1-3H2,(H,13,17)(H,14,15) |
| InChIKey | WBCZINFYGSFRPI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|