C10H11BrClN3O — CID 103582487
3-[(5-bromo-3-chloro-2-pyridinyl)amino]piperidin-2-one (PubChem CID 103582487) has the molecular formula C10H11BrClN3O and a molecular weight of 304.58 g/mol. Its IUPAC name is 3-[(5-bromo-3-chloro-2-pyridinyl)amino]piperidin-2-one.
| Compound Name | 3-[(5-bromo-3-chloro-2-pyridinyl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 103582487 |
| Molecular Formula | C10H11BrClN3O |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 3-[(5-bromo-3-chloro-2-pyridinyl)amino]piperidin-2-one |
| SMILES | O=C1NCCCC1Nc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C10H11BrClN3O/c11-6-4-7(12)9(14-5-6)15-8-2-1-3-13-10(8)16/h4-5,8H,1-3H2,(H,13,16)(H,14,15) |
| InChIKey | PXLCYVWETOFMKU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |