C11H11BrCl2N2O3S — CID 49149515
4-bromo-2,6-dichloro-N-(2-oxopiperidin-3-yl)benzenesulfonamide (PubChem CID 49149515) has the molecular formula C11H11BrCl2N2O3S and a molecular weight of 402.10 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2-oxopiperidin-3-yl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(2-oxopiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 49149515 |
| Molecular Formula | C11H11BrCl2N2O3S |
| Molecular Weight | 402.10 g/mol |
| Exact Mass | 399.91 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2-oxopiperidin-3-yl)benzenesulfonamide |
| SMILES | O=C1NCCCC1NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C11H11BrCl2N2O3S/c12-6-4-7(13)10(8(14)5-6)20(18,19)16-9-2-1-3-15-11(9)17/h4-5,9,16H,1-3H2,(H,15,17) |
| InChIKey | GFOYARACMLMUGJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.10 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |