C11H12BrFN2O3S — CID 103697534
4-bromo-3-fluoro-N-(2-oxopiperidin-3-yl)benzenesulfonamide (PubChem CID 103697534) has the molecular formula C11H12BrFN2O3S and a molecular weight of 351.20 g/mol. Its IUPAC name is 4-bromo-3-fluoro-N-(2-oxopiperidin-3-yl)benzenesulfonamide.
| Compound Name | 4-bromo-3-fluoro-N-(2-oxopiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103697534 |
| Molecular Formula | C11H12BrFN2O3S |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 4-bromo-3-fluoro-N-(2-oxopiperidin-3-yl)benzenesulfonamide |
| SMILES | O=C1NCCCC1NS(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C11H12BrFN2O3S/c12-8-4-3-7(6-9(8)13)19(17,18)15-10-2-1-5-14-11(10)16/h3-4,6,10,15H,1-2,5H2,(H,14,16) |
| InChIKey | KKRMXMFFRJZAPT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |