C12H14FN3O3S2 — CID 63288833
2-fluoro-5-[(2-oxopiperidin-3-yl)sulfamoyl]benzenecarbothioamide (PubChem CID 63288833) has the molecular formula C12H14FN3O3S2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-fluoro-5-[(2-oxopiperidin-3-yl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-5-[(2-oxopiperidin-3-yl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 63288833 |
| Molecular Formula | C12H14FN3O3S2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 2-fluoro-5-[(2-oxopiperidin-3-yl)sulfamoyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(S(=O)(=O)NC2CCCNC2=O)ccc1F |
| InChI | InChI=1S/C12H14FN3O3S2/c13-9-4-3-7(6-8(9)11(14)20)21(18,19)16-10-2-1-5-15-12(10)17/h3-4,6,10,16H,1-2,5H2,(H2,14,20)(H,15,17) |
| InChIKey | HXIMHNSJKKJSEK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|