C12H13F3N2O3S — CID 54761931
N-[(3S)-2-oxopiperidin-3-yl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 54761931) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is N-[(3S)-2-oxopiperidin-3-yl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(3S)-2-oxopiperidin-3-yl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54761931 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-[(3S)-2-oxopiperidin-3-yl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C1NCCC[C@@H]1NS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O3S/c13-12(14,15)8-3-5-9(6-4-8)21(19,20)17-10-2-1-7-16-11(10)18/h3-6,10,17H,1-2,7H2,(H,16,18)/t10-/m0/s1 |
| InChIKey | KTBVUQPZOGPMNM-JTQLQIEISA-N |
| XLogP | 1.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |