C15H18N4O3S — CID 3770703
N-(2-oxoazepan-3-yl)-4-pyrazol-1-ylbenzenesulfonamide (PubChem CID 3770703) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(2-oxoazepan-3-yl)-4-pyrazol-1-ylbenzenesulfonamide.
| Compound Name | N-(2-oxoazepan-3-yl)-4-pyrazol-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 3770703 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(2-oxoazepan-3-yl)-4-pyrazol-1-ylbenzenesulfonamide |
| SMILES | O=C1NCCCCC1NS(=O)(=O)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C15H18N4O3S/c20-15-14(4-1-2-9-16-15)18-23(21,22)13-7-5-12(6-8-13)19-11-3-10-17-19/h3,5-8,10-11,14,18H,1-2,4,9H2,(H,16,20) |
| InChIKey | UTLBKZZANPEOQF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |