C17H21N5O2 — CID 94058390
1-[(3S)-2-oxoazepan-3-yl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 94058390) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-[(3S)-2-oxoazepan-3-yl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-[(3S)-2-oxoazepan-3-yl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 94058390 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[(3S)-2-oxoazepan-3-yl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(-n2cccn2)cc1)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C17H21N5O2/c23-16-15(4-1-2-9-18-16)21-17(24)19-12-13-5-7-14(8-6-13)22-11-3-10-20-22/h3,5-8,10-11,15H,1-2,4,9,12H2,(H,18,23)(H2,19,21,24)/t15-/m0/s1 |
| InChIKey | LCJCVYZJKHXMLL-HNNXBMFYSA-N |
| XLogP | 1.34 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |