C17H25N5O3 — CID 51084089
1-[(6-morpholin-4-yl-3-pyridinyl)methyl]-3-(2-oxoazepan-3-yl)urea (PubChem CID 51084089) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[(6-morpholin-4-yl-3-pyridinyl)methyl]-3-(2-oxoazepan-3-yl)urea.
| Compound Name | 1-[(6-morpholin-4-yl-3-pyridinyl)methyl]-3-(2-oxoazepan-3-yl)urea |
|---|---|
| PubChem CID | 51084089 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-[(6-morpholin-4-yl-3-pyridinyl)methyl]-3-(2-oxoazepan-3-yl)urea |
| SMILES | O=C(NCc1ccc(N2CCOCC2)nc1)NC1CCCCNC1=O |
| InChI | InChI=1S/C17H25N5O3/c23-16-14(3-1-2-6-18-16)21-17(24)20-12-13-4-5-15(19-11-13)22-7-9-25-10-8-22/h4-5,11,14H,1-3,6-10,12H2,(H,18,23)(H2,20,21,24) |
| InChIKey | MDYBEHFEPPROPB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |