C15H19Cl2N3O2 — CID 42473931
(1R)-2,2-dichloro-1-methyl-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]cyclopropane-1-carboxamide (PubChem CID 42473931) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is (1R)-2,2-dichloro-1-methyl-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-1-methyl-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 42473931 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (1R)-2,2-dichloro-1-methyl-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]cyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)NCc2ccc(N3CCOCC3)nc2)CC1(Cl)Cl |
| InChI | InChI=1S/C15H19Cl2N3O2/c1-14(10-15(14,16)17)13(21)19-9-11-2-3-12(18-8-11)20-4-6-22-7-5-20/h2-3,8H,4-7,9-10H2,1H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | KHKZNPMWXVGTQJ-CQSZACIVSA-N |
| XLogP | 2.12 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|