C21H33N5O3 — CID 16615005
4-(cyclohexylcarbamoylamino)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]butanamide (PubChem CID 16615005) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]butanamide |
|---|---|
| PubChem CID | 16615005 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NCc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C21H33N5O3/c27-20(7-4-10-22-21(28)25-18-5-2-1-3-6-18)24-16-17-8-9-19(23-15-17)26-11-13-29-14-12-26/h8-9,15,18H,1-7,10-14,16H2,(H,24,27)(H2,22,25,28) |
| InChIKey | JVOCUNVKHPMSDP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|