C14H22N4O2 — CID 97071107
1-[(1,5-dimethylpyrrol-2-yl)methyl]-3-[(3S)-2-oxoazepan-3-yl]urea (PubChem CID 97071107) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrrol-2-yl)methyl]-3-[(3S)-2-oxoazepan-3-yl]urea.
| Compound Name | 1-[(1,5-dimethylpyrrol-2-yl)methyl]-3-[(3S)-2-oxoazepan-3-yl]urea |
|---|---|
| PubChem CID | 97071107 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-[(1,5-dimethylpyrrol-2-yl)methyl]-3-[(3S)-2-oxoazepan-3-yl]urea |
| SMILES | Cc1ccc(CNC(=O)N[C@H]2CCCCNC2=O)n1C |
| InChI | InChI=1S/C14H22N4O2/c1-10-6-7-11(18(10)2)9-16-14(20)17-12-5-3-4-8-15-13(12)19/h6-7,12H,3-5,8-9H2,1-2H3,(H,15,19)(H2,16,17,20)/t12-/m0/s1 |
| InChIKey | ATNSVJHDVRGDDH-LBPRGKRZSA-N |
| XLogP | 0.80 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |