C11H13FN2O3S — CID 49457165
3-fluoro-N-(2-oxopiperidin-3-yl)benzenesulfonamide (PubChem CID 49457165) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-fluoro-N-(2-oxopiperidin-3-yl)benzenesulfonamide.
| Compound Name | 3-fluoro-N-(2-oxopiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 49457165 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-fluoro-N-(2-oxopiperidin-3-yl)benzenesulfonamide |
| SMILES | O=C1NCCCC1NS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H13FN2O3S/c12-8-3-1-4-9(7-8)18(16,17)14-10-5-2-6-13-11(10)15/h1,3-4,7,10,14H,2,5-6H2,(H,13,15) |
| InChIKey | KDVUKMNRJOZRSD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |