C12H15BrN2O3S — CID 51979851
2-bromo-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide (PubChem CID 51979851) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is 2-bromo-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 51979851 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-bromo-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide |
| SMILES | O=C1NCCCC[C@H]1NS(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C12H15BrN2O3S/c13-9-5-1-2-7-11(9)19(17,18)15-10-6-3-4-8-14-12(10)16/h1-2,5,7,10,15H,3-4,6,8H2,(H,14,16)/t10-/m1/s1 |
| InChIKey | VKDACKPQIPMWES-SNVBAGLBSA-N |
| XLogP | 1.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |